CAS 1415719-59-3 is the registry number for Methyl 2-[(4-aminophenyl)thio]isonicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 2-(4-aminophenyl)sulfanylpyridine-4-carboxylate (CAS 1415719-59-3) is a chemical compound with the molecular formula C13H12N2O2S and a molecular weight of 260.31 g/mol. IUPAC name: methyl 2-(4-aminophenyl)sulfanylpyridine-4-carboxylate. InChIKey: KYCVAQMLDGJEBK-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | methyl 2-(4-aminophenyl)sulfanylpyridine-4-carboxylate |
| InChIKey | KYCVAQMLDGJEBK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC=C1)SC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)