Products 1240620-05-6
CAS 1240620-05-6 is the registry number for 1-(5-(2,2,2-Trifluoroethoxy)pyridin-2-yl)ethanone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanone (CAS 1240620-05-6) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanone. InChIKey: IXECYNPZHXXTAN-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanone |
| InChIKey | IXECYNPZHXXTAN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC=C(C=C1)OCC(F)(F)F |
Computed by PubChem (NCBI)