Products 1240948-77-9
CAS 1240948-77-9 appears in our catalog under these names: Vonoprazan Impurity 74, Vonoprazan Impuirty 64, 5–(2–Fluorophenyl)–1H–pyrrole–3–carbonitrile, 5-(2-Fluorophenyl)-1H-pyrrole-3-carbonitrile, 5-(2-Fluorophenyl)-1H-pyrrole-3-carbonitrile 95%. Offered by: Chemat Brand, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 5g, 250g, 250mg, 1g, 25g, 100g, 10g.
5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile (CAS 1240948-77-9) is a chemical compound with the molecular formula C11H7FN2 and a molecular weight of 186.18 g/mol. IUPAC name: 5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile. InChIKey: ZDEFHFJZEDEKJO-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2 |
|---|---|
| Molecular weight | 186.18 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile |
| InChIKey | ZDEFHFJZEDEKJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CN2)C#N)F |
Computed by PubChem (NCBI)