CAS 136343-75-4 is the registry number for 8-Fluoropyrido(1,2-a)benzimidazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
8-fluoropyrido[1,2-a]benzimidazole (CAS 136343-75-4) is a chemical compound with the molecular formula C11H7FN2 and a molecular weight of 186.18 g/mol. IUPAC name: 8-fluoropyrido[1,2-a]benzimidazole. InChIKey: SKAUYRBSZAILJU-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2 |
|---|---|
| Molecular weight | 186.18 g/mol |
| IUPAC name | 8-fluoropyrido[1,2-a]benzimidazole |
| InChIKey | SKAUYRBSZAILJU-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC3=C(N2C=C1)C=C(C=C3)F |
Computed by PubChem (NCBI)