Products 136343-75-4

CAS 136343-75-4 is the registry number for 8-Fluoropyrido(1,2-a)benzimidazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

8-fluoropyrido[1,2-a]benzimidazole (CAS 136343-75-4) is a chemical compound with the molecular formula C11H7FN2 and a molecular weight of 186.18 g/mol. IUPAC name: 8-fluoropyrido[1,2-a]benzimidazole. InChIKey: SKAUYRBSZAILJU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7FN2
Molecular weight186.18 g/mol
IUPAC name8-fluoropyrido[1,2-a]benzimidazole
InChIKeySKAUYRBSZAILJU-UHFFFAOYSA-N
SMILESC1=CC2=NC3=C(N2C=C1)C=C(C=C3)F

Computed by PubChem (NCBI)