CAS 170169-86-5 is the registry number for 2-(4-Fluorophenyl)cyclopropane-1,1-dicarbonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2-(4-fluorophenyl)cyclopropane-1,1-dicarbonitrile (CAS 170169-86-5) is a chemical compound with the molecular formula C11H7FN2 and a molecular weight of 186.18 g/mol. IUPAC name: 2-(4-fluorophenyl)cyclopropane-1,1-dicarbonitrile. InChIKey: IUBOUWJHLPQEJV-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2 |
|---|---|
| Molecular weight | 186.18 g/mol |
| IUPAC name | 2-(4-fluorophenyl)cyclopropane-1,1-dicarbonitrile |
| InChIKey | IUBOUWJHLPQEJV-UHFFFAOYSA-N |
| SMILES | C1C(C1(C#N)C#N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)