CAS 1241217-09-3 is the registry number for 6-((1-(2,5-Dimethylfuran-3-yl)ethyl)amino)nicotinonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-[1-(2,5-dimethylfuran-3-yl)ethylamino]pyridine-3-carbonitrile (CAS 1241217-09-3) is a chemical compound with the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. IUPAC name: 6-[1-(2,5-dimethylfuran-3-yl)ethylamino]pyridine-3-carbonitrile. InChIKey: ORIHBNKLROLJNK-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | 6-[1-(2,5-dimethylfuran-3-yl)ethylamino]pyridine-3-carbonitrile |
| InChIKey | ORIHBNKLROLJNK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C)C(C)NC2=NC=C(C=C2)C#N |
Computed by PubChem (NCBI)