CAS 1241373-24-9 is the registry number for 2-chloro-5-methyl-3-nitropyridine 1-oxide. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5-methyl-3-nitro-1-oxidopyridin-1-ium (CAS 1241373-24-9) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 2-chloro-5-methyl-3-nitro-1-oxidopyridin-1-ium. InChIKey: FREQEDGGNGKEDW-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 2-chloro-5-methyl-3-nitro-1-oxidopyridin-1-ium |
| InChIKey | FREQEDGGNGKEDW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C([N+](=C1)[O-])Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)