CAS 1241675-11-5 is the registry number for 4-Bromo-5-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(benzenesulfonyl)-4-bromo-5-chloropyrrolo[2,3-b]pyridine (CAS 1241675-11-5) is a chemical compound with the molecular formula C13H8BrClN2O2S and a molecular weight of 371.64 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-bromo-5-chloropyrrolo[2,3-b]pyridine. InChIKey: VYMJDRRGNYPYOI-UHFFFAOYSA-N.
| Molecular formula | C13H8BrClN2O2S |
|---|---|
| Molecular weight | 371.64 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-bromo-5-chloropyrrolo[2,3-b]pyridine |
| InChIKey | VYMJDRRGNYPYOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(C(=CN=C32)Cl)Br |
Computed by PubChem (NCBI)