CAS 920966-51-4 appears in our catalog under these names: 3-Bromo-4-chloro-1-(phenylsulfonyl)-1h-pyrrolo[2,3-b]pyridine, 95%, 3-Bromo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 98%, 98%, 3-BROMO-4-CHLORO-1-(PHENYLSULFONYL)-1H-PYRROLO[2,3-B]PYRIDINE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 10g.
1-(benzenesulfonyl)-3-bromo-4-chloropyrrolo[2,3-b]pyridine (CAS 920966-51-4) is a chemical compound with the molecular formula C13H8BrClN2O2S and a molecular weight of 371.64 g/mol. IUPAC name: 1-(benzenesulfonyl)-3-bromo-4-chloropyrrolo[2,3-b]pyridine. InChIKey: PBMVFDCNDQMFCU-UHFFFAOYSA-N.
| Molecular formula | C13H8BrClN2O2S |
|---|---|
| Molecular weight | 371.64 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-3-bromo-4-chloropyrrolo[2,3-b]pyridine |
| InChIKey | PBMVFDCNDQMFCU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C(C=CN=C32)Cl)Br |
Computed by PubChem (NCBI)