CAS 1305325-01-2 is the registry number for 5-Bromo-7-chloro-1-(phenylsulfonyl)-1h-pyrrolo[2,3-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(benzenesulfonyl)-5-bromo-7-chloropyrrolo[2,3-c]pyridine (CAS 1305325-01-2) is a chemical compound with the molecular formula C13H8BrClN2O2S and a molecular weight of 371.64 g/mol. IUPAC name: 1-(benzenesulfonyl)-5-bromo-7-chloropyrrolo[2,3-c]pyridine. InChIKey: WDUFAOLROHWSPB-UHFFFAOYSA-N.
| Molecular formula | C13H8BrClN2O2S |
|---|---|
| Molecular weight | 371.64 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5-bromo-7-chloropyrrolo[2,3-c]pyridine |
| InChIKey | WDUFAOLROHWSPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CC(=NC(=C32)Cl)Br |
Computed by PubChem (NCBI)