Products 1241679-39-9
CAS 1241679-39-9 is the registry number for (S)-1-(3-fluoro-5-(trifluoromethyl)phenyl)ethan-1-amine, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanamine (CAS 1241679-39-9) is a chemical compound with the molecular formula C9H9F4N and a molecular weight of 207.17 g/mol. IUPAC name: (1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanamine. InChIKey: CYBTYBCFSPUKPL-YFKPBYRVSA-N.
| Molecular formula | C9H9F4N |
|---|---|
| Molecular weight | 207.17 g/mol |
| IUPAC name | (1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanamine |
| InChIKey | CYBTYBCFSPUKPL-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=CC(=CC(=C1)F)C(F)(F)F)N |
Computed by PubChem (NCBI)