CAS 1241681-92-4 is the registry number for (S)-2-(3-Chloro-2,4,5-trifluorophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(3-chloro-2,4,5-trifluorophenyl)pyrrolidine (CAS 1241681-92-4) is a chemical compound with the molecular formula C10H9ClF3N and a molecular weight of 235.63 g/mol. IUPAC name: (2S)-2-(3-chloro-2,4,5-trifluorophenyl)pyrrolidine. InChIKey: HRILVIXRCDFKEY-ZETCQYMHSA-N.
| Molecular formula | C10H9ClF3N |
|---|---|
| Molecular weight | 235.63 g/mol |
| IUPAC name | (2S)-2-(3-chloro-2,4,5-trifluorophenyl)pyrrolidine |
| InChIKey | HRILVIXRCDFKEY-ZETCQYMHSA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=C(C(=C2F)Cl)F)F |
Computed by PubChem (NCBI)