Products 154875-85-1
CAS 154875-85-1 is the registry number for N-(3,5-Dimethylphenyl)-2,2,2-trifluoroacetimidoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3,5-dimethylphenyl)-2,2,2-trifluoroethanimidoyl chloride (CAS 154875-85-1) is a chemical compound with the molecular formula C10H9ClF3N and a molecular weight of 235.63 g/mol. IUPAC name: N-(3,5-dimethylphenyl)-2,2,2-trifluoroethanimidoyl chloride. InChIKey: IZCBLEAYDSAQDO-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3N |
|---|---|
| Molecular weight | 235.63 g/mol |
| IUPAC name | N-(3,5-dimethylphenyl)-2,2,2-trifluoroethanimidoyl chloride |
| InChIKey | IZCBLEAYDSAQDO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N=C(C(F)(F)F)Cl)C |
Computed by PubChem (NCBI)