CAS 1783561-93-2 is the registry number for 6-Chloro-4-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline (CAS 1783561-93-2) is a chemical compound with the molecular formula C10H9ClF3N and a molecular weight of 235.63 g/mol. IUPAC name: 6-chloro-4-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline. InChIKey: GLBHDYOCOHCJSR-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3N |
|---|---|
| Molecular weight | 235.63 g/mol |
| IUPAC name | 6-chloro-4-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | GLBHDYOCOHCJSR-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(CN1)C=CC(=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)