CAS 1241683-27-1 is the registry number for 2-Phenyl-D-phenylalanine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-2-amino-3-(2-phenylphenyl)propanoic acid (CAS 1241683-27-1) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: (2R)-2-amino-3-(2-phenylphenyl)propanoic acid. InChIKey: DBMVJVZQGTXWTP-CQSZACIVSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-phenylphenyl)propanoic acid |
| InChIKey | DBMVJVZQGTXWTP-CQSZACIVSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)