Products 1241800-33-8

CAS 1241800-33-8 is the registry number for Dihexyl 3,3'-(pyrazine-2,5-diyl)dipropanoate. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Cyclohexyl 3-[5-(3-cyclohexyloxy-3-oxopropyl)pyrazin-2-yl]propanoate (CAS 1241800-33-8) is a chemical compound with the molecular formula C22H32N2O4 and a molecular weight of 388.5 g/mol. IUPAC name: cyclohexyl 3-[5-(3-cyclohexyloxy-3-oxopropyl)pyrazin-2-yl]propanoate. InChIKey: ZKCRTXRUWPQSAX-UHFFFAOYSA-N.

Identity
Molecular formulaC22H32N2O4
Molecular weight388.5 g/mol
IUPAC namecyclohexyl 3-[5-(3-cyclohexyloxy-3-oxopropyl)pyrazin-2-yl]propanoate
InChIKeyZKCRTXRUWPQSAX-UHFFFAOYSA-N
SMILESC1CCC(CC1)OC(=O)CCC2=CN=C(C=N2)CCC(=O)OC3CCCCC3

Computed by PubChem (NCBI)