Products 2089649-33-0

CAS 2089649-33-0 is the registry number for 7-(phenylmethyl)-, 2-(1,1-dimethylethyl) 9-ethyl Ester 2,7-Diazaspiro(4.4)nonane-2,9-dicarboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

7-O-tert-butyl 4-O-ethyl 2-benzyl-2,7-diazaspiro[4.4]nonane-4,7-dicarboxylate (CAS 2089649-33-0) is a chemical compound with the molecular formula C22H32N2O4 and a molecular weight of 388.5 g/mol. IUPAC name: 7-O-tert-butyl 4-O-ethyl 2-benzyl-2,7-diazaspiro[4.4]nonane-4,7-dicarboxylate. InChIKey: YSMJRXHRUBYVTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H32N2O4
Molecular weight388.5 g/mol
IUPAC name7-O-tert-butyl 4-O-ethyl 2-benzyl-2,7-diazaspiro[4.4]nonane-4,7-dicarboxylate
InChIKeyYSMJRXHRUBYVTJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1CN(CC12CCN(C2)C(=O)OC(C)(C)C)CC3=CC=CC=C3

Computed by PubChem (NCBI)