CAS 124211-72-9 appears in our catalog under these names: 4'-Iso-propyl-2,2,2-trifluoroacetophenone, 95%, 2,2,2-trifluoro-1-[4-(propan-2-yl)phenyl]ethan-1-one, ≥95%, ≥95%, 4'-iso-Propyl-2,2,2-trifluoroacetophenone. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
2,2,2-trifluoro-1-(4-propan-2-ylphenyl)ethanone (CAS 124211-72-9) is a chemical compound with the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-propan-2-ylphenyl)ethanone. InChIKey: JXAARZPBEHNXIL-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-propan-2-ylphenyl)ethanone |
| InChIKey | JXAARZPBEHNXIL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)