Products 1512450-66-6
CAS 1512450-66-6 is the registry number for 1-(2,4,6-Trifluorophenyl)cyclopentanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
1-(2,4,6-trifluorophenyl)cyclopentan-1-ol (CAS 1512450-66-6) is a chemical compound with the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. IUPAC name: 1-(2,4,6-trifluorophenyl)cyclopentan-1-ol. InChIKey: GWQIUWRHVGWOMI-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 1-(2,4,6-trifluorophenyl)cyclopentan-1-ol |
| InChIKey | GWQIUWRHVGWOMI-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=C(C=C(C=C2F)F)F)O |
Computed by PubChem (NCBI)