CAS 1270297-25-0 is the registry number for (S)-6-(Trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 1270297-25-0) is a chemical compound with the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. IUPAC name: (1S)-6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: XCBFZUFBBYAXSZ-JTQLQIEISA-N.
| Molecular formula | C11H11F3O |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | (1S)-6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | XCBFZUFBBYAXSZ-JTQLQIEISA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=C(C=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)