CAS 1242137-21-8 is the registry number for N-(4-(Aminocarbonyl)-3-fluorophenyl)-2-methylalanine Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
Methyl 2-(4-carbamoyl-3-fluoroanilino)-2-methylpropanoate (CAS 1242137-21-8) is a chemical compound with the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. IUPAC name: methyl 2-(4-carbamoyl-3-fluoroanilino)-2-methylpropanoate. InChIKey: RKZPPQSTEMLROE-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O3 |
|---|---|
| Molecular weight | 254.26 g/mol |
| IUPAC name | methyl 2-(4-carbamoyl-3-fluoroanilino)-2-methylpropanoate |
| InChIKey | RKZPPQSTEMLROE-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)OC)NC1=CC(=C(C=C1)C(=O)N)F |
Computed by PubChem (NCBI)