Products 1242137-21-8

CAS 1242137-21-8 is the registry number for N-(4-(Aminocarbonyl)-3-fluorophenyl)-2-methylalanine Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

Methyl 2-(4-carbamoyl-3-fluoroanilino)-2-methylpropanoate (CAS 1242137-21-8) is a chemical compound with the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. IUPAC name: methyl 2-(4-carbamoyl-3-fluoroanilino)-2-methylpropanoate. InChIKey: RKZPPQSTEMLROE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15FN2O3
Molecular weight254.26 g/mol
IUPAC namemethyl 2-(4-carbamoyl-3-fluoroanilino)-2-methylpropanoate
InChIKeyRKZPPQSTEMLROE-UHFFFAOYSA-N
SMILESCC(C)(C(=O)OC)NC1=CC(=C(C=C1)C(=O)N)F

Computed by PubChem (NCBI)