CAS 1289942-66-0 appears in our catalog under these names: Enzalutamide Impurity 18, 2-((3-Fluoro-4-(methylcarbamoyl)phenyl)amino)-2-methylpropanoic acid, >95% (HPLC), N-(3-Fluoro-4-((methylamino)carbonyl)phenyl)-2-methylalanine, 2-((3-Fluoro-4-(methylcarbamoyl)phenyl)amino)-2-methylpropanoic acid 97%, 2-((3-Fluoro-4-(methylcarbamoyl)phenyl)amino)-2-methylpropanoic acid, 97%, 97%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 100mg, 10mg, 50mg, 100g, 1g, 5g, 10g.
2-[3-fluoro-4-(methylcarbamoyl)anilino]-2-methylpropanoic acid (CAS 1289942-66-0) is a chemical compound with the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. IUPAC name: 2-[3-fluoro-4-(methylcarbamoyl)anilino]-2-methylpropanoic acid. InChIKey: IAAHEGARPMZSTJ-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O3 |
|---|---|
| Molecular weight | 254.26 g/mol |
| IUPAC name | 2-[3-fluoro-4-(methylcarbamoyl)anilino]-2-methylpropanoic acid |
| InChIKey | IAAHEGARPMZSTJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NC1=CC(=C(C=C1)C(=O)NC)F |
Computed by PubChem (NCBI)