Products 1281784-50-6
CAS 1281784-50-6 is the registry number for 3-[(5-Fluoro-2-nitrophenoxy)methyl]piperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[(5-fluoro-2-nitrophenoxy)methyl]piperidine (CAS 1281784-50-6) is a chemical compound with the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. IUPAC name: 3-[(5-fluoro-2-nitrophenoxy)methyl]piperidine. InChIKey: YSQLQYQOKVNCJV-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O3 |
|---|---|
| Molecular weight | 254.26 g/mol |
| IUPAC name | 3-[(5-fluoro-2-nitrophenoxy)methyl]piperidine |
| InChIKey | YSQLQYQOKVNCJV-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)COC2=C(C=CC(=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)