CAS 1242289-39-9 is the registry number for 7-Chloro-2-phenylbenzothiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-chloro-2-phenyl-1,3-benzothiazole (CAS 1242289-39-9) is a chemical compound with the molecular formula C13H8ClNS and a molecular weight of 245.73 g/mol. IUPAC name: 7-chloro-2-phenyl-1,3-benzothiazole. InChIKey: VMZHCIMYHJIMEW-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNS |
|---|---|
| Molecular weight | 245.73 g/mol |
| IUPAC name | 7-chloro-2-phenyl-1,3-benzothiazole |
| InChIKey | VMZHCIMYHJIMEW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(S2)C(=CC=C3)Cl |
Computed by PubChem (NCBI)