Products 952-16-9
CAS 952-16-9 appears in our catalog under these names: 5-Chloro-2-phenylbenzo(d)thiazole, 95-<97%, 5-Chloro-2-phenyl-1,3-benzothiazole. Offered by: Hoffman Fine Chemicals, Biosynth. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g, 0,5g, 50mg.
5-chloro-2-phenyl-1,3-benzothiazole (CAS 952-16-9) is a chemical compound with the molecular formula C13H8ClNS and a molecular weight of 245.73 g/mol. IUPAC name: 5-chloro-2-phenyl-1,3-benzothiazole. InChIKey: SVTDXKPYBJXBJR-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNS |
|---|---|
| Molecular weight | 245.73 g/mol |
| IUPAC name | 5-chloro-2-phenyl-1,3-benzothiazole |
| InChIKey | SVTDXKPYBJXBJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(S2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)