CAS 37539-80-3 is the registry number for 1-Chlorodibenzo(b,f)(1,4)thiazepine. Offered by: TRC. Available pack sizes: 250mg.
7-chlorobenzo[b][1,4]benzothiazepine (CAS 37539-80-3) is a chemical compound with the molecular formula C13H8ClNS and a molecular weight of 245.73 g/mol. IUPAC name: 7-chlorobenzo[b][1,4]benzothiazepine. InChIKey: LBDDYEVEGAFVBT-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNS |
|---|---|
| Molecular weight | 245.73 g/mol |
| IUPAC name | 7-chlorobenzo[b][1,4]benzothiazepine |
| InChIKey | LBDDYEVEGAFVBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC3=C(S2)C=CC=C3Cl |
Computed by PubChem (NCBI)