Products 124251-84-9
CAS 124251-84-9 appears in our catalog under these names: 1-Naphthol-D7, >95% (HPLC), 1-Naphthol-2,3,4,5,6,7,8-d7, 1-NAPHTHOL-2,3,4,5,6,7,8-D7, 97 ATOM % D, 1-Naphthol-d7, 99.44%. Offered by: TRC, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 100mg, 1G, 5 mg, 10 mg.
2,3,4,5,6,7,8-heptadeuterionaphthalen-1-ol (CAS 124251-84-9) is a chemical compound with the molecular formula C10H8O and a molecular weight of 151.21 g/mol. IUPAC name: 2,3,4,5,6,7,8-heptadeuterionaphthalen-1-ol. InChIKey: KJCVRFUGPWSIIH-GSNKEKJESA-N.
| Molecular formula | C10H8O |
|---|---|
| Molecular weight | 151.21 g/mol |
| IUPAC name | 2,3,4,5,6,7,8-heptadeuterionaphthalen-1-ol |
| InChIKey | KJCVRFUGPWSIIH-GSNKEKJESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2O)[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)