CAS 1329509-54-7 is the registry number for 1-Naphthol-13C10. Offered by: TRC. Available pack sizes: 10mg.
Naphthalen-1-ol (CAS 1329509-54-7) is a chemical compound with the molecular formula C10H8O and a molecular weight of 154.097 g/mol. IUPAC name: naphthalen-1-ol. InChIKey: KJCVRFUGPWSIIH-IIYFYTTLSA-N.
| Molecular formula | C10H8O |
|---|---|
| Molecular weight | 154.097 g/mol |
| IUPAC name | naphthalen-1-ol |
| InChIKey | KJCVRFUGPWSIIH-IIYFYTTLSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]2[13C](=[13CH]1)[13CH]=[13CH][13CH]=[13C]2O |
Computed by PubChem (NCBI)