Products 1242960-01-5
CAS 1242960-01-5 is the registry number for 1-(2-Aminoethyl)-N,N-dimethyl-1H-benzo[d]imidazole-5-sulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-aminoethyl)-N,N-dimethylbenzimidazole-5-sulfonamide (CAS 1242960-01-5) is a chemical compound with the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. IUPAC name: 1-(2-aminoethyl)-N,N-dimethylbenzimidazole-5-sulfonamide. InChIKey: NTWKLFKKBYYJLQ-UHFFFAOYSA-N.
| Molecular formula | C11H16N4O2S |
|---|---|
| Molecular weight | 268.34 g/mol |
| IUPAC name | 1-(2-aminoethyl)-N,N-dimethylbenzimidazole-5-sulfonamide |
| InChIKey | NTWKLFKKBYYJLQ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC2=C(C=C1)N(C=N2)CCN |
Computed by PubChem (NCBI)