Products 706767-04-6
CAS 706767-04-6 is the registry number for 3-(2-(dimethylamino)ethyl)-1-(4-nitrophenyl)thiourea. Offered by: Biosynth. Available pack sizes: 250mg.
1-[2-(dimethylamino)ethyl]-3-(4-nitrophenyl)thiourea (CAS 706767-04-6) is a chemical compound with the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. IUPAC name: 1-[2-(dimethylamino)ethyl]-3-(4-nitrophenyl)thiourea. InChIKey: CGVUMRRPWSWRNS-UHFFFAOYSA-N.
| Molecular formula | C11H16N4O2S |
|---|---|
| Molecular weight | 268.34 g/mol |
| IUPAC name | 1-[2-(dimethylamino)ethyl]-3-(4-nitrophenyl)thiourea |
| InChIKey | CGVUMRRPWSWRNS-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC(=S)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)