CAS 2737542-87-7 is the registry number for 3-(3-Amino-6-methyl-2,3-dihydro-1H-pyrazolo[3,4-b]pyridin-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-dioxothiolan-3-yl)-6-methyl-2,3-dihydropyrazolo[3,4-b]pyridin-3-amine (CAS 2737542-87-7) is a chemical compound with the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)-6-methyl-2,3-dihydropyrazolo[3,4-b]pyridin-3-amine. InChIKey: ZCGMAHSJWQATTG-UHFFFAOYSA-N.
| Molecular formula | C11H16N4O2S |
|---|---|
| Molecular weight | 268.34 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)-6-methyl-2,3-dihydropyrazolo[3,4-b]pyridin-3-amine |
| InChIKey | ZCGMAHSJWQATTG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(NN2C3CCS(=O)(=O)C3)N |
Computed by PubChem (NCBI)