CAS 1243102-22-8 is the registry number for 3-(3-Ethyl-3H-imidazo[4,5-b]pyridin-2-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-ethylimidazo[4,5-b]pyridin-2-yl)benzoic acid (CAS 1243102-22-8) is a chemical compound with the molecular formula C15H13N3O2 and a molecular weight of 267.28 g/mol. IUPAC name: 3-(3-ethylimidazo[4,5-b]pyridin-2-yl)benzoic acid. InChIKey: IAAYJZCAVNAHAB-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O2 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 3-(3-ethylimidazo[4,5-b]pyridin-2-yl)benzoic acid |
| InChIKey | IAAYJZCAVNAHAB-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=CC=N2)N=C1C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)