Products 1243145-24-5
CAS 1243145-24-5 is the registry number for ethyl 2-(2-bromo-4-methoxy-phenyl)-3-oxo-butanoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Ethyl 2-(2-bromo-4-methoxyphenyl)-3-oxobutanoate (CAS 1243145-24-5) is a chemical compound with the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. IUPAC name: ethyl 2-(2-bromo-4-methoxyphenyl)-3-oxobutanoate. InChIKey: YFAZONZHJXTVCM-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO4 |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | ethyl 2-(2-bromo-4-methoxyphenyl)-3-oxobutanoate |
| InChIKey | YFAZONZHJXTVCM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C=C(C=C1)OC)Br)C(=O)C |
Computed by PubChem (NCBI)