CAS 2135331-42-7 appears in our catalog under these names: 1-(3-bromophenyl)-3,3-dimethoxycyclobutane-1-carboxylic acid, 95%, 95%, 1-(3-BROMOPHENYL)-3,3-DIMETHOXYCYCLOBUTANE-1-CARBOXYLIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
1-(3-bromophenyl)-3,3-dimethoxycyclobutane-1-carboxylic acid (CAS 2135331-42-7) is a chemical compound with the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. IUPAC name: 1-(3-bromophenyl)-3,3-dimethoxycyclobutane-1-carboxylic acid. InChIKey: YILPZHYOSWHUDU-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO4 |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | 1-(3-bromophenyl)-3,3-dimethoxycyclobutane-1-carboxylic acid |
| InChIKey | YILPZHYOSWHUDU-UHFFFAOYSA-N |
| SMILES | COC1(CC(C1)(C2=CC(=CC=C2)Br)C(=O)O)OC |
Computed by PubChem (NCBI)