CAS 713104-51-9 is the registry number for 3-Bromo-4-(cyclopentyloxy)-5-methoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g.
3-bromo-4-cyclopentyloxy-5-methoxybenzoic acid (CAS 713104-51-9) is a chemical compound with the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. IUPAC name: 3-bromo-4-cyclopentyloxy-5-methoxybenzoic acid. InChIKey: CSIGUGGJAICJPV-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO4 |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | 3-bromo-4-cyclopentyloxy-5-methoxybenzoic acid |
| InChIKey | CSIGUGGJAICJPV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)O)Br)OC2CCCC2 |
Computed by PubChem (NCBI)