CAS 1243249-99-1 is the registry number for 6-Bromopyrazolo[1,5-a]pyrimidine-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-bromopyrazolo[1,5-a]pyrimidine-3-carboxamide (CAS 1243249-99-1) is a chemical compound with the molecular formula C7H5BrN4O and a molecular weight of 241.04 g/mol. IUPAC name: 6-bromopyrazolo[1,5-a]pyrimidine-3-carboxamide. InChIKey: OQZSRBNENJIRBN-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4O |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 6-bromopyrazolo[1,5-a]pyrimidine-3-carboxamide |
| InChIKey | OQZSRBNENJIRBN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C(C=NN21)C(=O)N)Br |
Computed by PubChem (NCBI)