CAS 2229489-50-1 is the registry number for 3-(5-Bromopyrimidin-2-yl)isoxazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-bromopyrimidin-2-yl)-1,2-oxazol-5-amine (CAS 2229489-50-1) is a chemical compound with the molecular formula C7H5BrN4O and a molecular weight of 241.04 g/mol. IUPAC name: 3-(5-bromopyrimidin-2-yl)-1,2-oxazol-5-amine. InChIKey: BDFGAIAFFVAOOO-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4O |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 3-(5-bromopyrimidin-2-yl)-1,2-oxazol-5-amine |
| InChIKey | BDFGAIAFFVAOOO-UHFFFAOYSA-N |
| SMILES | C1=C(ON=C1C2=NC=C(C=N2)Br)N |
Computed by PubChem (NCBI)