CAS 944718-29-0 is the registry number for 5-(5-Bromopyridin-2-yl)-1,3,4-oxadiazol-2-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-(5-bromo-2-pyridinyl)-1,3,4-oxadiazol-2-amine (CAS 944718-29-0) is a chemical compound with the molecular formula C7H5BrN4O and a molecular weight of 241.04 g/mol. IUPAC name: 5-(5-bromo-2-pyridinyl)-1,3,4-oxadiazol-2-amine. InChIKey: LCURBDWCMSYHQB-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4O |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 5-(5-bromo-2-pyridinyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | LCURBDWCMSYHQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)C2=NN=C(O2)N |
Computed by PubChem (NCBI)