Products 1243288-05-2
CAS 1243288-05-2 appears in our catalog under these names: 4-Bromo-2-hydroxy-N,N-dimethylbenzamide, 4-Bromo-2-hydroxy-N,N-dimethylbenzamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
4-bromo-2-hydroxy-N,N-dimethylbenzamide (CAS 1243288-05-2) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 4-bromo-2-hydroxy-N,N-dimethylbenzamide. InChIKey: XTDKZCLZWZIPGN-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 4-bromo-2-hydroxy-N,N-dimethylbenzamide |
| InChIKey | XTDKZCLZWZIPGN-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)Br)O |
Computed by PubChem (NCBI)