Products 1243395-76-7

CAS 1243395-76-7 is the registry number for 2-Formyl-5-hydroxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-formyl-5-hydroxybenzoic acid (CAS 1243395-76-7) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: 2-formyl-5-hydroxybenzoic acid. InChIKey: SEAUZPDOQOCEET-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6O4
Molecular weight166.13 g/mol
IUPAC name2-formyl-5-hydroxybenzoic acid
InChIKeySEAUZPDOQOCEET-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1O)C(=O)O)C=O

Computed by PubChem (NCBI)