CAS 60088-54-2 appears in our catalog under these names: Terephthalic-d4 acid, 95%, Terephthalic-d4 Acid, >95% (HPLC), Terephthalic-2,3,5,6-d4 Acid, 98 atom % D, min 98% Chemical Purity, Terephthalic–d4 acid, Terephthalic acid–d4. Offered by: Combi-blocks, TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 1g, 500mg, 5g, 250mg, 50mg, 100mg, 100 mg, 50 mg.
2,3,5,6-tetradeuterioterephthalic acid (CAS 60088-54-2) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 170.15 g/mol. IUPAC name: 2,3,5,6-tetradeuterioterephthalic acid. InChIKey: KKEYFWRCBNTPAC-RHQRLBAQSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 170.15 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterioterephthalic acid |
| InChIKey | KKEYFWRCBNTPAC-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)