Products 1243437-79-7
CAS 1243437-79-7 is the registry number for 4-Bromo-3-hydroxy-N,N-dimethylbenzamide, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-3-hydroxy-N,N-dimethylbenzamide (CAS 1243437-79-7) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 4-bromo-3-hydroxy-N,N-dimethylbenzamide. InChIKey: HIRKZPYVZCNOQS-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 4-bromo-3-hydroxy-N,N-dimethylbenzamide |
| InChIKey | HIRKZPYVZCNOQS-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)Br)O |
Computed by PubChem (NCBI)