Products 1243556-64-0
CAS 1243556-64-0 is the registry number for rel-6-((3aR,4R,7S,7aS)-1,3-Dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)hexanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
6-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]hexanoic acid (CAS 1243556-64-0) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 6-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]hexanoic acid. InChIKey: JAWZRFZAOPGTPT-QZHINBJYSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 6-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]hexanoic acid |
| InChIKey | JAWZRFZAOPGTPT-QZHINBJYSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@H]3[C@@H]2C(=O)N(C3=O)CCCCCC(=O)O |
Computed by PubChem (NCBI)