CAS 1243989-49-2 is the registry number for N-(3'-Nitro[1,1'-biphenyl]-2-yl)-acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
N-[2-(3-nitrophenyl)phenyl]acetamide (CAS 1243989-49-2) is a chemical compound with the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. IUPAC name: N-[2-(3-nitrophenyl)phenyl]acetamide. InChIKey: LEKLMGTZPSFOGM-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | N-[2-(3-nitrophenyl)phenyl]acetamide |
| InChIKey | LEKLMGTZPSFOGM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC=C1C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)