CAS 1284791-14-5 is the registry number for 2,9-Dimethyl-1-oxo-2,9-dihydro-1h-beta-carboline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2,9-dimethyl-1-oxopyrido[3,4-b]indole-4-carboxylic acid (CAS 1284791-14-5) is a chemical compound with the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. IUPAC name: 2,9-dimethyl-1-oxopyrido[3,4-b]indole-4-carboxylic acid. InChIKey: CBJCQWKWCLTLIS-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 2,9-dimethyl-1-oxopyrido[3,4-b]indole-4-carboxylic acid |
| InChIKey | CBJCQWKWCLTLIS-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C(C1=O)N(C3=CC=CC=C32)C)C(=O)O |
Computed by PubChem (NCBI)