CAS 1244039-65-3 is the registry number for 2–Chloro–5–fluoro–3–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)aniline. Offered by: GLPBio. Available pack sizes: 250mg.
2-chloro-5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1244039-65-3) is a chemical compound with the molecular formula C12H16BClFNO2 and a molecular weight of 271.52 g/mol. IUPAC name: 2-chloro-5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: LXMXPKGROLGLJT-UHFFFAOYSA-N.
| Molecular formula | C12H16BClFNO2 |
|---|---|
| Molecular weight | 271.52 g/mol |
| IUPAC name | 2-chloro-5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | LXMXPKGROLGLJT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2Cl)N)F |
Computed by PubChem (NCBI)