CAS 1244949-19-6 appears in our catalog under these names: 1-(5-Fluoro-2,3-dihydro-1h-inden-2-yl)ethanone, 95%, 1–(5–Fluoro–2,3–dihydro–1H–inden–2–yl)ethanone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
1-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethanone (CAS 1244949-19-6) is a chemical compound with the molecular formula C11H11FO and a molecular weight of 178.20 g/mol. IUPAC name: 1-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethanone. InChIKey: CMBMMXSLPWDLNP-UHFFFAOYSA-N.
| Molecular formula | C11H11FO |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 1-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethanone |
| InChIKey | CMBMMXSLPWDLNP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CC2=C(C1)C=C(C=C2)F |
Computed by PubChem (NCBI)