CAS 1501959-50-7 appears in our catalog under these names: 4-Fluoro-3,3-dimethyl-2,3-dihydro-1h-inden-1-one, 95%, 4–Fluoro–3,3–dimethyl–2,3–dihydro–1H–inden–1–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-fluoro-3,3-dimethyl-2H-inden-1-one (CAS 1501959-50-7) is a chemical compound with the molecular formula C11H11FO and a molecular weight of 178.20 g/mol. IUPAC name: 4-fluoro-3,3-dimethyl-2H-inden-1-one. InChIKey: JWPBSHXDWNOBPC-UHFFFAOYSA-N.
| Molecular formula | C11H11FO |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 4-fluoro-3,3-dimethyl-2H-inden-1-one |
| InChIKey | JWPBSHXDWNOBPC-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C1C(=CC=C2)F)C |
Computed by PubChem (NCBI)