CAS 1479-20-5 is the registry number for 2-Fluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (CAS 1479-20-5) is a chemical compound with the molecular formula C11H11FO and a molecular weight of 178.20 g/mol. IUPAC name: 2-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one. InChIKey: ZRPVSEIZXMFKOP-UHFFFAOYSA-N.
| Molecular formula | C11H11FO |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 2-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| InChIKey | ZRPVSEIZXMFKOP-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C2=C(C1)C=C(C=C2)F |
Computed by PubChem (NCBI)