CAS 124508-14-1 is the registry number for (S,S,S,R)-Isosorbide. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,3aS,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol (CAS 124508-14-1) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. IUPAC name: (3S,3aS,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol. InChIKey: KLDXJTOLSGUMSJ-FSIIMWSLSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 146.14 g/mol |
| IUPAC name | (3S,3aS,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol |
| InChIKey | KLDXJTOLSGUMSJ-FSIIMWSLSA-N |
| SMILES | C1[C@H]([C@H]2[C@@H](O1)[C@H](CO2)O)O |
Computed by PubChem (NCBI)